C32H48O4 — CID 70017990
1-(2,5-dipentoxyphenyl)-3-(5-ethyl-2-pentoxyphenyl)propan-1-one (PubChem CID 70017990) has the molecular formula C32H48O4 and a molecular weight of 496.73 g/mol. Its IUPAC name is 1-(2,5-dipentoxyphenyl)-3-(5-ethyl-2-pentoxyphenyl)propan-1-one.
| Compound Name | 1-(2,5-dipentoxyphenyl)-3-(5-ethyl-2-pentoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 70017990 |
| Molecular Formula | C32H48O4 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | 1-(2,5-dipentoxyphenyl)-3-(5-ethyl-2-pentoxyphenyl)propan-1-one |
| SMILES | CCCCCOc1ccc(OCCCCC)c(C(=O)CCc2cc(CC)ccc2OCCCCC)c1 |
| InChI | InChI=1S/C32H48O4/c1-5-9-12-21-34-28-17-20-32(36-23-14-11-7-3)29(25-28)30(33)18-16-27-24-26(8-4)15-19-31(27)35-22-13-10-6-2/h15,17,19-20,24-25H,5-14,16,18,21-23H2,1-4H3 |
| InChIKey | AAEREXOZCADFLK-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|