About 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate
4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate (PubChem CID 58019660) has the molecular formula C36H60O9
and a molecular weight of 636.87 g/mol. Its IUPAC name is 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate |
| PubChem CID | 58019660 |
| Molecular Formula | C36H60O9 |
| Molecular Weight | 636.87 g/mol |
| Exact Mass | 636.42 |
| IUPAC Name | 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate |
| SMILES | CCCCCCCCOc1ccc(OCCCCCCCCOC(=O)CCC(=O)OCCC)c(C(=O)OCCCCCCO)c1 |
| InChI | InChI=1S/C36H60O9/c1-3-5-6-7-11-16-26-41-31-20-21-33(32(30-31)36(40)45-29-19-14-10-15-24-37)42-27-17-12-8-9-13-18-28-44-35(39)23-22-34(38)43-25-4-2/h20-21,30,37H,3-19,22-29H2,1-2H3 |
| InChIKey | KHNXDPOZVDWZBL-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 636.87 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate?
The IUPAC name of 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate (CID 58019660) is 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate.
What is the SMILES notation for 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate?
The canonical SMILES for 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate is CCCCCCCCOc1ccc(OCCCCCCCCOC(=O)CCC(=O)OCCC)c(C(=O)OCCCCCCO)c1.
What is the InChIKey of 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate?
The InChIKey is KHNXDPOZVDWZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H60O9/c1-3-5-6-7-11-16-26-41-31-20-21-33(32(30-31)36(40)45-29-19-14-10-15-24-37)42-27-17-12-8-9-13-18-28-44-35(39)23-22-34(38)43-25-4-2/h20-21,30,37H,3-19,22-29H2,1-2H3.
What are the key properties of 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate?
4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate has a molecular weight of 636.87 g/mol, XLogP of 8.13, 30 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-octoxyphenoxy]octyl] 1-O-propyl butanedioate is sourced from PubChem (CID 58019660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).