C61H58O10 — CID 168916997
butyl 2,5-bis[[4-[2-[6-(6-hydroxyhexoxy)naphthalen-2-yl]ethynyl]benzoyl]oxy]benzoate (PubChem CID 168916997) has the molecular formula C61H58O10 and a molecular weight of 951.12 g/mol. Its IUPAC name is butyl 2,5-bis[[4-[2-[6-(6-hydroxyhexoxy)naphthalen-2-yl]ethynyl]benzoyl]oxy]benzoate.
| Compound Name | butyl 2,5-bis[[4-[2-[6-(6-hydroxyhexoxy)naphthalen-2-yl]ethynyl]benzoyl]oxy]benzoate |
|---|---|
| PubChem CID | 168916997 |
| Molecular Formula | C61H58O10 |
| Molecular Weight | 951.12 g/mol |
| Exact Mass | 950.40 |
| IUPAC Name | butyl 2,5-bis[[4-[2-[6-(6-hydroxyhexoxy)naphthalen-2-yl]ethynyl]benzoyl]oxy]benzoate |
| SMILES | CCCCOC(=O)c1cc(OC(=O)c2ccc(C#Cc3ccc4cc(OCCCCCCO)ccc4c3)cc2)ccc1OC(=O)c1ccc(C#Cc2ccc3cc(OCCCCCCO)ccc3c2)cc1 |
| InChI | InChI=1S/C61H58O10/c1-2-3-36-69-61(66)57-43-56(70-59(64)48-22-16-44(17-23-48)12-14-46-20-26-52-41-54(30-28-50(52)39-46)67-37-10-6-4-8-34-62)32-33-58(57)71-60(65)49-24-18-45(19-25-49)13-15-47-21-27-53-42-55(31-29-51(53)40-47)68-38-11-7-5-9-35-63/h16-33,39-43,62-63H,2-11,34-38H2,1H3 |
| InChIKey | AKPRYHIEBLTQJX-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.12 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|