C36H31IO8 — CID 168916969
methyl 5-[4-[2-[4-(6-hydroxyhexoxy)phenyl]ethynyl]benzoyl]oxy-2-(4-iodobenzoyl)oxybenzoate (PubChem CID 168916969) has the molecular formula C36H31IO8 and a molecular weight of 718.54 g/mol. Its IUPAC name is methyl 5-[4-[2-[4-(6-hydroxyhexoxy)phenyl]ethynyl]benzoyl]oxy-2-(4-iodobenzoyl)oxybenzoate.
| Compound Name | methyl 5-[4-[2-[4-(6-hydroxyhexoxy)phenyl]ethynyl]benzoyl]oxy-2-(4-iodobenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 168916969 |
| Molecular Formula | C36H31IO8 |
| Molecular Weight | 718.54 g/mol |
| Exact Mass | 718.11 |
| IUPAC Name | methyl 5-[4-[2-[4-(6-hydroxyhexoxy)phenyl]ethynyl]benzoyl]oxy-2-(4-iodobenzoyl)oxybenzoate |
| SMILES | COC(=O)c1cc(OC(=O)c2ccc(C#Cc3ccc(OCCCCCCO)cc3)cc2)ccc1OC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C36H31IO8/c1-42-36(41)32-24-31(20-21-33(32)45-35(40)28-14-16-29(37)17-15-28)44-34(39)27-12-8-25(9-13-27)6-7-26-10-18-30(19-11-26)43-23-5-3-2-4-22-38/h8-21,24,38H,2-5,22-23H2,1H3 |
| InChIKey | ZUDWBHHKJJBJJW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|