C76H73NO13 — CID 168916957
8-[4-(4-cyanophenyl)phenoxy]octyl 2,5-bis[[4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethynyl]benzoyl]oxy]benzoate (PubChem CID 168916957) has the molecular formula C76H73NO13 and a molecular weight of 1208.41 g/mol. Its IUPAC name is 8-[4-(4-cyanophenyl)phenoxy]octyl 2,5-bis[[4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethynyl]benzoyl]oxy]benzoate.
| Compound Name | 8-[4-(4-cyanophenyl)phenoxy]octyl 2,5-bis[[4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethynyl]benzoyl]oxy]benzoate |
|---|---|
| PubChem CID | 168916957 |
| Molecular Formula | C76H73NO13 |
| Molecular Weight | 1208.41 g/mol |
| Exact Mass | 1207.51 |
| IUPAC Name | 8-[4-(4-cyanophenyl)phenoxy]octyl 2,5-bis[[4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethynyl]benzoyl]oxy]benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C#Cc2ccc(C(=O)Oc3ccc(OC(=O)c4ccc(C#Cc5ccc(OCCCCCCOC(=O)C=C)cc5)cc4)c(C(=O)OCCCCCCCCOc4ccc(-c5ccc(C#N)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C76H73NO13/c1-3-72(78)86-52-16-11-9-14-50-83-66-41-29-59(30-42-66)21-19-57-23-35-64(36-24-57)74(80)89-69-47-48-71(70(55-69)76(82)88-54-18-8-6-5-7-13-49-85-68-45-39-63(40-46-68)62-33-27-61(56-77)28-34-62)90-75(81)65-37-25-58(26-38-65)20-22-60-31-43-67(44-32-60)84-51-15-10-12-17-53-87-73(79)4-2/h3-4,23-48,55H,1-2,5-18,49-54H2 |
| InChIKey | RQMAZRMYMRTDEP-UHFFFAOYSA-N |
| XLogP | 15.38 |
| TPSA | 182.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 90 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1208.41 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|