C54H52O12 — CID 175194492
bicyclo[2.2.0]hexa-1,3,5-triene;(4-ethynylphenyl)methyl 2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoate (PubChem CID 175194492) has the molecular formula C54H52O12 and a molecular weight of 893.00 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;(4-ethynylphenyl)methyl 2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoate.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;(4-ethynylphenyl)methyl 2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoate |
|---|---|
| PubChem CID | 175194492 |
| Molecular Formula | C54H52O12 |
| Molecular Weight | 893.00 g/mol |
| Exact Mass | 892.35 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;(4-ethynylphenyl)methyl 2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoate |
| SMILES | C#Cc1ccc(COC(=O)c2cc(OC(=O)c3ccc(OCCCCCCOC(=O)C=C)cc3)ccc2OC(=O)c2ccc(OCCCCCCOC(=O)C=C)cc2)cc1.c1cc2ccc1-2 |
| InChI | InChI=1S/C48H48O12.C6H4/c1-4-35-15-17-36(18-16-35)34-58-48(53)42-33-41(59-46(51)37-19-23-39(24-20-37)54-29-11-7-9-13-31-56-44(49)5-2)27-28-43(42)60-47(52)38-21-25-40(26-22-38)55-30-12-8-10-14-32-57-45(50)6-3;1-2-6-4-3-5(1)6/h1,5-6,15-28,33H,2-3,7-14,29-32,34H2;1-4H |
| InChIKey | JSODGHVARQHVFB-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.00 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|