C54H53NO13 — CID 175185614
bicyclo[2.2.0]hexa-1,3,5-triene;2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoic acid;4-ethynylbenzamide (PubChem CID 175185614) has the molecular formula C54H53NO13 and a molecular weight of 924.01 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoic acid;4-ethynylbenzamide.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoic acid;4-ethynylbenzamide |
|---|---|
| PubChem CID | 175185614 |
| Molecular Formula | C54H53NO13 |
| Molecular Weight | 924.01 g/mol |
| Exact Mass | 923.35 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoic acid;4-ethynylbenzamide |
| SMILES | C#Cc1ccc(C(N)=O)cc1.C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCCOC(=O)C=C)cc3)c(C(=O)O)c2)cc1.c1cc2ccc1-2 |
| InChI | InChI=1S/C39H42O12.C9H7NO.C6H4/c1-3-35(40)48-25-11-7-5-9-23-46-30-17-13-28(14-18-30)38(44)50-32-21-22-34(33(27-32)37(42)43)51-39(45)29-15-19-31(20-16-29)47-24-10-6-8-12-26-49-36(41)4-2;1-2-7-3-5-8(6-4-7)9(10)11;1-2-6-4-3-5(1)6/h3-4,13-22,27H,1-2,5-12,23-26H2,(H,42,43);1,3-6H,(H2,10,11);1-4H |
| InChIKey | VYPVPJHBRBPUFO-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 204.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.01 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|