About 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate
4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate (PubChem CID 58027873) has the molecular formula C37H60O11
and a molecular weight of 680.88 g/mol. Its IUPAC name is 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate |
| PubChem CID | 58027873 |
| Molecular Formula | C37H60O11 |
| Molecular Weight | 680.88 g/mol |
| Exact Mass | 680.41 |
| IUPAC Name | 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate |
| SMILES | CCC(=O)OCCCCCCCCOc1ccc(OCCCCCCCCOC(=O)CCC(=O)OC)c(C(=O)OCCCCCCO)c1 |
| InChI | InChI=1S/C37H60O11/c1-3-34(39)46-27-17-11-6-4-9-15-25-44-31-20-21-33(32(30-31)37(42)48-29-19-13-8-14-24-38)45-26-16-10-5-7-12-18-28-47-36(41)23-22-35(40)43-2/h20-21,30,38H,3-19,22-29H2,1-2H3 |
| InChIKey | MYILWKMDDXAYGM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 680.88 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate?
The IUPAC name of 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate (CID 58027873) is 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate.
What is the SMILES notation for 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate?
The canonical SMILES for 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate is CCC(=O)OCCCCCCCCOc1ccc(OCCCCCCCCOC(=O)CCC(=O)OC)c(C(=O)OCCCCCCO)c1.
What is the InChIKey of 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate?
The InChIKey is MYILWKMDDXAYGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H60O11/c1-3-34(39)46-27-17-11-6-4-9-15-25-44-31-20-21-33(32(30-31)37(42)48-29-19-13-8-14-24-38)45-26-16-10-5-7-12-18-28-47-36(41)23-22-35(40)43-2/h20-21,30,38H,3-19,22-29H2,1-2H3.
What are the key properties of 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate?
4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate has a molecular weight of 680.88 g/mol, XLogP of 7.28, 31 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[8-[2-(6-hydroxyhexoxycarbonyl)-4-(8-propanoyloxyoctoxy)phenoxy]octyl] 1-O-methyl butanedioate is sourced from PubChem (CID 58027873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).