C35H54O10 — CID 59147863
1-O-heptyl 4-O-[6-[4-methoxy-2-[6-(2-methylprop-2-enoyloxy)hexoxycarbonyl]phenoxy]hexyl] butanedioate (PubChem CID 59147863) has the molecular formula C35H54O10 and a molecular weight of 634.81 g/mol. Its IUPAC name is 1-O-heptyl 4-O-[6-[4-methoxy-2-[6-(2-methylprop-2-enoyloxy)hexoxycarbonyl]phenoxy]hexyl] butanedioate.
| Compound Name | 1-O-heptyl 4-O-[6-[4-methoxy-2-[6-(2-methylprop-2-enoyloxy)hexoxycarbonyl]phenoxy]hexyl] butanedioate |
|---|---|
| PubChem CID | 59147863 |
| Molecular Formula | C35H54O10 |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | 1-O-heptyl 4-O-[6-[4-methoxy-2-[6-(2-methylprop-2-enoyloxy)hexoxycarbonyl]phenoxy]hexyl] butanedioate |
| SMILES | C=C(C)C(=O)OCCCCCCOC(=O)c1cc(OC)ccc1OCCCCCCOC(=O)CCC(=O)OCCCCCCC |
| InChI | InChI=1S/C35H54O10/c1-5-6-7-8-14-23-42-32(36)20-21-33(37)43-24-15-10-9-13-22-41-31-19-18-29(40-4)27-30(31)35(39)45-26-17-12-11-16-25-44-34(38)28(2)3/h18-19,27H,2,5-17,20-26H2,1,3-4H3 |
| InChIKey | XTCZJAGJDLEIIX-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|