C28H36N2O5 — CID 102100257
pentyl 4-[[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]diazenyl]benzoate (PubChem CID 102100257) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is pentyl 4-[[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]diazenyl]benzoate.
| Compound Name | pentyl 4-[[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 102100257 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | pentyl 4-[[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]diazenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(/N=N/c2ccc(C(=O)OCCCCC)cc2)cc1 |
| InChI | InChI=1S/C28H36N2O5/c1-4-5-8-20-35-28(32)23-11-13-24(14-12-23)29-30-25-15-17-26(18-16-25)33-19-9-6-7-10-21-34-27(31)22(2)3/h11-18H,2,4-10,19-21H2,1,3H3/b30-29+ |
| InChIKey | YBMHBLZOXGODCF-QVIHXGFCSA-N |
| XLogP | 7.51 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|