C52H72N5O6+ — CID 101028822
bis[6-[4-[(4-hexoxycarbonylphenyl)diazenyl]phenoxy]hexyl]-dimethylazanium (PubChem CID 101028822) has the molecular formula C52H72N5O6+ and a molecular weight of 863.18 g/mol. Its IUPAC name is bis[6-[4-[(4-hexoxycarbonylphenyl)diazenyl]phenoxy]hexyl]-dimethylazanium.
| Compound Name | bis[6-[4-[(4-hexoxycarbonylphenyl)diazenyl]phenoxy]hexyl]-dimethylazanium |
|---|---|
| PubChem CID | 101028822 |
| Molecular Formula | C52H72N5O6+ |
| Molecular Weight | 863.18 g/mol |
| Exact Mass | 862.55 |
| IUPAC Name | bis[6-[4-[(4-hexoxycarbonylphenyl)diazenyl]phenoxy]hexyl]-dimethylazanium |
| SMILES | CCCCCCOC(=O)c1ccc(/N=N/c2ccc(OCCCCCC[N+](C)(C)CCCCCCOc3ccc(/N=N/c4ccc(C(=O)OCCCCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C52H72N5O6/c1-5-7-9-17-41-62-51(58)43-21-25-45(26-22-43)53-55-47-29-33-49(34-30-47)60-39-19-13-11-15-37-57(3,4)38-16-12-14-20-40-61-50-35-31-48(32-36-50)56-54-46-27-23-44(24-28-46)52(59)63-42-18-10-8-6-2/h21-36H,5-20,37-42H2,1-4H3/q+1/b55-53+,56-54+ |
| InChIKey | LXMXLXDFDFSVEY-DSZBTAPASA-N |
| XLogP | 14.65 |
| TPSA | 120.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.18 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|