C29H34N4O4 — CID 137270173
4-[(4-methoxyphenyl)diazenyl]-N'-(4-octoxybenzoyl)benzohydrazide (PubChem CID 137270173) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)diazenyl]-N'-(4-octoxybenzoyl)benzohydrazide.
| Compound Name | 4-[(4-methoxyphenyl)diazenyl]-N'-(4-octoxybenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 137270173 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 4-[(4-methoxyphenyl)diazenyl]-N'-(4-octoxybenzoyl)benzohydrazide |
| SMILES | CCCCCCCCOc1ccc(C(=O)NNC(=O)c2ccc(/N=N/c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H34N4O4/c1-3-4-5-6-7-8-21-37-27-17-11-23(12-18-27)29(35)33-32-28(34)22-9-13-24(14-10-22)30-31-25-15-19-26(36-2)20-16-25/h9-20H,3-8,21H2,1-2H3,(H,32,34)(H,33,35)/b31-30+ |
| InChIKey | BDXIOJWQUCGIFH-NVQSTNCTSA-N |
| XLogP | 6.92 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|