About 9-hydroxynonyl propanoate
9-hydroxynonyl propanoate (PubChem CID 90020173) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is 9-hydroxynonyl propanoate.
Molecular Properties
| Compound Name | 9-hydroxynonyl propanoate |
| PubChem CID | 90020173 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 9-hydroxynonyl propanoate |
| SMILES | CCC(=O)OCCCCCCCCCO |
| InChI | InChI=1S/C12H24O3/c1-2-12(14)15-11-9-7-5-3-4-6-8-10-13/h13H,2-11H2,1H3 |
| InChIKey | NLMPUHFLKJGUKT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxynonyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxynonyl propanoate?
The IUPAC name of 9-hydroxynonyl propanoate (CID 90020173) is 9-hydroxynonyl propanoate.
What is the SMILES notation for 9-hydroxynonyl propanoate?
The canonical SMILES for 9-hydroxynonyl propanoate is CCC(=O)OCCCCCCCCCO.
What is the InChIKey of 9-hydroxynonyl propanoate?
The InChIKey is NLMPUHFLKJGUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-2-12(14)15-11-9-7-5-3-4-6-8-10-13/h13H,2-11H2,1H3.
What are the key properties of 9-hydroxynonyl propanoate?
9-hydroxynonyl propanoate has a molecular weight of 216.32 g/mol, XLogP of 2.66, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxynonyl propanoate is sourced from PubChem (CID 90020173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).