C53H87NO8 — CID 130446759
2-[3-[4-(dimethylamino)butanoyloxymethyl]-4-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethoxy]phenoxy]ethyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 130446759) has the molecular formula C53H87NO8 and a molecular weight of 866.28 g/mol. Its IUPAC name is 2-[3-[4-(dimethylamino)butanoyloxymethyl]-4-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethoxy]phenoxy]ethyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2-[3-[4-(dimethylamino)butanoyloxymethyl]-4-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethoxy]phenoxy]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 130446759 |
| Molecular Formula | C53H87NO8 |
| Molecular Weight | 866.28 g/mol |
| Exact Mass | 865.64 |
| IUPAC Name | 2-[3-[4-(dimethylamino)butanoyloxymethyl]-4-[2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyethoxy]phenoxy]ethyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCOc1ccc(OCCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC)c(COC(=O)CCCN(C)C)c1 |
| InChI | InChI=1S/C53H87NO8/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-51(55)60-44-42-58-49-39-40-50(48(46-49)47-62-53(57)38-35-41-54(3)4)59-43-45-61-52(56)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,39-40,46H,5-12,17-18,23-38,41-45,47H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | IUVCFESVJIVTBW-KWXKLSQISA-N |
| XLogP | 13.54 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.28 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|