C47H76O7 — CID 139438405
2-[3-[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxyethoxy]-5-(hydroxymethyl)phenoxy]ethyl (9Z,13Z)-nonadeca-9,13-dienoate (PubChem CID 139438405) has the molecular formula C47H76O7 and a molecular weight of 753.12 g/mol. Its IUPAC name is 2-[3-[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxyethoxy]-5-(hydroxymethyl)phenoxy]ethyl (9Z,13Z)-nonadeca-9,13-dienoate.
| Compound Name | 2-[3-[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxyethoxy]-5-(hydroxymethyl)phenoxy]ethyl (9Z,13Z)-nonadeca-9,13-dienoate |
|---|---|
| PubChem CID | 139438405 |
| Molecular Formula | C47H76O7 |
| Molecular Weight | 753.12 g/mol |
| Exact Mass | 752.56 |
| IUPAC Name | 2-[3-[2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxyethoxy]-5-(hydroxymethyl)phenoxy]ethyl (9Z,13Z)-nonadeca-9,13-dienoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OCCOc1cc(CO)cc(OCCOC(=O)CCCCCCC/C=C\CC/C=C\CCCCC)c1 |
| InChI | InChI=1S/C47H76O7/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-47(50)54-38-36-52-45-40-43(42-48)39-44(41-45)51-35-37-53-46(49)33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h10-13,16,18-20,39-41,48H,3-9,14-15,17,21-38,42H2,1-2H3/b12-10-,13-11-,18-16-,20-19- |
| InChIKey | CLNDZPYJGWSBHP-GAALXIHLSA-N |
| XLogP | 12.65 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.12 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|