C54H89NO8 — CID 146359707
4-[3-[[2-(methylamino)acetyl]oxymethyl]-5-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 146359707) has the molecular formula C54H89NO8 and a molecular weight of 880.30 g/mol. Its IUPAC name is 4-[3-[[2-(methylamino)acetyl]oxymethyl]-5-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 4-[3-[[2-(methylamino)acetyl]oxymethyl]-5-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 146359707 |
| Molecular Formula | C54H89NO8 |
| Molecular Weight | 880.30 g/mol |
| Exact Mass | 879.66 |
| IUPAC Name | 4-[3-[[2-(methylamino)acetyl]oxymethyl]-5-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCCOc1cc(COC(=O)CNC)cc(OCCCCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC)c1 |
| InChI | InChI=1S/C54H89NO8/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-38-52(56)61-42-36-34-40-59-50-44-49(48-63-54(58)47-55-3)45-51(46-50)60-41-35-37-43-62-53(57)39-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,44-46,55H,4-11,16-17,22-43,47-48H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | APGDOWNBCVJETL-QYCRHRGJSA-N |
| XLogP | 13.98 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.30 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|