C46H77NO4 — CID 144696181
[3,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 2-(methylamino)acetate (PubChem CID 144696181) has the molecular formula C46H77NO4 and a molecular weight of 708.12 g/mol. Its IUPAC name is [3,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 2-(methylamino)acetate.
| Compound Name | [3,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 2-(methylamino)acetate |
|---|---|
| PubChem CID | 144696181 |
| Molecular Formula | C46H77NO4 |
| Molecular Weight | 708.12 g/mol |
| Exact Mass | 707.59 |
| IUPAC Name | [3,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 2-(methylamino)acetate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOc1cc(COC(=O)CNC)cc(OCCCCCCCC/C=C\C/C=C\CCCCC)c1 |
| InChI | InChI=1S/C46H77NO4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-49-44-38-43(42-51-46(48)41-47-3)39-45(40-44)50-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,38-40,47H,4-11,16-17,22-37,41-42H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | YNNKSXRZAXCWSH-QYCRHRGJSA-N |
| XLogP | 13.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.12 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|