C48H77NO6 — CID 123733357
[3-[3-(dimethylamino)propanoyloxymethyl]-5-octadeca-9,12-dienoyloxyphenyl] octadeca-9,12-dienoate (PubChem CID 123733357) has the molecular formula C48H77NO6 and a molecular weight of 764.14 g/mol. Its IUPAC name is [3-[3-(dimethylamino)propanoyloxymethyl]-5-octadeca-9,12-dienoyloxyphenyl] octadeca-9,12-dienoate.
| Compound Name | [3-[3-(dimethylamino)propanoyloxymethyl]-5-octadeca-9,12-dienoyloxyphenyl] octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 123733357 |
| Molecular Formula | C48H77NO6 |
| Molecular Weight | 764.14 g/mol |
| Exact Mass | 763.58 |
| IUPAC Name | [3-[3-(dimethylamino)propanoyloxymethyl]-5-octadeca-9,12-dienoyloxyphenyl] octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)Oc1cc(COC(=O)CCN(C)C)cc(OC(=O)CCCCCCCC=CCC=CCCCCC)c1 |
| InChI | InChI=1S/C48H77NO6/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-47(51)54-44-39-43(42-53-46(50)37-38-49(3)4)40-45(41-44)55-48(52)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,39-41H,5-12,17-18,23-38,42H2,1-4H3 |
| InChIKey | OLTFDFPQQONFKJ-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.14 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|