C49H83NO4 — CID 123371606
[4-methyl-3,5-bis(octadeca-9,12-dienoxy)phenyl]methyl 3-(dimethylamino)propanoate (PubChem CID 123371606) has the molecular formula C49H83NO4 and a molecular weight of 750.21 g/mol. Its IUPAC name is [4-methyl-3,5-bis(octadeca-9,12-dienoxy)phenyl]methyl 3-(dimethylamino)propanoate.
| Compound Name | [4-methyl-3,5-bis(octadeca-9,12-dienoxy)phenyl]methyl 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 123371606 |
| Molecular Formula | C49H83NO4 |
| Molecular Weight | 750.21 g/mol |
| Exact Mass | 749.63 |
| IUPAC Name | [4-methyl-3,5-bis(octadeca-9,12-dienoxy)phenyl]methyl 3-(dimethylamino)propanoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCOc1cc(COC(=O)CCN(C)C)cc(OCCCCCCCCC=CCC=CCCCCC)c1C |
| InChI | InChI=1S/C49H83NO4/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40-52-47-42-46(44-54-49(51)38-39-50(4)5)43-48(45(47)3)53-41-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,42-43H,6-13,18-19,24-41,44H2,1-5H3 |
| InChIKey | BOUIGCIPURQRCZ-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.21 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|