C56H95NO6 — CID 86295644
4-[5-(diethylaminomethyl)-2-methyl-3-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 86295644) has the molecular formula C56H95NO6 and a molecular weight of 878.38 g/mol. Its IUPAC name is 4-[5-(diethylaminomethyl)-2-methyl-3-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 4-[5-(diethylaminomethyl)-2-methyl-3-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 86295644 |
| Molecular Formula | C56H95NO6 |
| Molecular Weight | 878.38 g/mol |
| Exact Mass | 877.72 |
| IUPAC Name | 4-[5-(diethylaminomethyl)-2-methyl-3-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCCOc1cc(CN(CC)CC)cc(OCCCCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC)c1C |
| InChI | InChI=1S/C56H95NO6/c1-6-10-12-14-16-18-20-22-24-26-28-30-32-34-36-42-55(58)62-46-40-38-44-60-53-48-52(50-57(8-3)9-4)49-54(51(53)5)61-45-39-41-47-63-56(59)43-37-35-33-31-29-27-25-23-21-19-17-15-13-11-7-2/h16-19,22-25,48-49H,6-15,20-21,26-47,50H2,1-5H3/b18-16-,19-17-,24-22-,25-23- |
| InChIKey | SNFYJWVMNGZYSR-HBZIWDQGSA-N |
| XLogP | 15.87 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.38 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|