C50H85NO8 — CID 123811813
4-[5-[(dimethylamino)methyl]-2-methyl-3-octadeca-9,12-dienoxyphenoxy]butyl 5-hexanoyloxy-4-(hexanoyloxymethyl)pentanoate (PubChem CID 123811813) has the molecular formula C50H85NO8 and a molecular weight of 828.23 g/mol. Its IUPAC name is 4-[5-[(dimethylamino)methyl]-2-methyl-3-octadeca-9,12-dienoxyphenoxy]butyl 5-hexanoyloxy-4-(hexanoyloxymethyl)pentanoate.
| Compound Name | 4-[5-[(dimethylamino)methyl]-2-methyl-3-octadeca-9,12-dienoxyphenoxy]butyl 5-hexanoyloxy-4-(hexanoyloxymethyl)pentanoate |
|---|---|
| PubChem CID | 123811813 |
| Molecular Formula | C50H85NO8 |
| Molecular Weight | 828.23 g/mol |
| Exact Mass | 827.63 |
| IUPAC Name | 4-[5-[(dimethylamino)methyl]-2-methyl-3-octadeca-9,12-dienoxyphenoxy]butyl 5-hexanoyloxy-4-(hexanoyloxymethyl)pentanoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCOc1cc(CN(C)C)cc(OCCCCOC(=O)CCC(COC(=O)CCCCC)COC(=O)CCCCC)c1C |
| InChI | InChI=1S/C50H85NO8/c1-7-10-13-14-15-16-17-18-19-20-21-22-23-24-25-28-35-55-46-38-45(40-51(5)6)39-47(43(46)4)56-36-29-30-37-57-50(54)34-33-44(41-58-48(52)31-26-11-8-2)42-59-49(53)32-27-12-9-3/h15-16,18-19,38-39,44H,7-14,17,20-37,40-42H2,1-6H3 |
| InChIKey | UQJJFMCLTHIBQD-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.23 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|