C53H87NO6 — CID 146359610
4-[3-[(dimethylamino)methyl]-5-[4-[(2E,9Z,15E)-octadeca-2,9,15-trienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 146359610) has the molecular formula C53H87NO6 and a molecular weight of 834.28 g/mol. Its IUPAC name is 4-[3-[(dimethylamino)methyl]-5-[4-[(2E,9Z,15E)-octadeca-2,9,15-trienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 4-[3-[(dimethylamino)methyl]-5-[4-[(2E,9Z,15E)-octadeca-2,9,15-trienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 146359610 |
| Molecular Formula | C53H87NO6 |
| Molecular Weight | 834.28 g/mol |
| Exact Mass | 833.65 |
| IUPAC Name | 4-[3-[(dimethylamino)methyl]-5-[4-[(2E,9Z,15E)-octadeca-2,9,15-trienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CC/C=C/CCCC/C=C\CCCCC/C=C/C(=O)OCCCCOc1cc(CN(C)C)cc(OCCCCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC)c1 |
| InChI | InChI=1S/C53H87NO6/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39-52(55)59-43-37-35-41-57-50-45-49(48-54(3)4)46-51(47-50)58-42-36-38-44-60-53(56)40-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h7,9,14,16,19-22,33,39,45-47H,5-6,8,10-13,15,17-18,23-32,34-38,40-44,48H2,1-4H3/b9-7+,16-14-,21-19-,22-20-,39-33+ |
| InChIKey | JECIBYYHKSQQNV-VMPBVMEDSA-N |
| XLogP | 14.56 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.28 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|