C45H77NO6 — CID 154406294
(Z)-18-[3-[(Z)-17-carboxyheptadec-10-enoxy]-5-[(dimethylamino)methyl]phenoxy]octadec-8-enoic acid (PubChem CID 154406294) has the molecular formula C45H77NO6 and a molecular weight of 728.11 g/mol. Its IUPAC name is (Z)-18-[3-[(Z)-17-carboxyheptadec-10-enoxy]-5-[(dimethylamino)methyl]phenoxy]octadec-8-enoic acid.
| Compound Name | (Z)-18-[3-[(Z)-17-carboxyheptadec-10-enoxy]-5-[(dimethylamino)methyl]phenoxy]octadec-8-enoic acid |
|---|---|
| PubChem CID | 154406294 |
| Molecular Formula | C45H77NO6 |
| Molecular Weight | 728.11 g/mol |
| Exact Mass | 727.58 |
| IUPAC Name | (Z)-18-[3-[(Z)-17-carboxyheptadec-10-enoxy]-5-[(dimethylamino)methyl]phenoxy]octadec-8-enoic acid |
| SMILES | CN(C)Cc1cc(OCCCCCCCCC/C=C\CCCCCCC(=O)O)cc(OCCCCCCCCC/C=C\CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C45H77NO6/c1-46(2)40-41-37-42(51-35-31-27-23-19-15-11-7-3-5-9-13-17-21-25-29-33-44(47)48)39-43(38-41)52-36-32-28-24-20-16-12-8-4-6-10-14-18-22-26-30-34-45(49)50/h5-6,9-10,37-39H,3-4,7-8,11-36,40H2,1-2H3,(H,47,48)(H,49,50)/b9-5-,10-6- |
| InChIKey | CBLUVTRWJVNUEM-OZDSWYPASA-N |
| XLogP | 12.71 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.11 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|