C51H83NO7 — CID 154406320
(9Z,12Z)-19-[3-[(7Z,10Z)-18-carboxyoctadeca-7,10-dienyl]-5-[3-(dimethylamino)propoxycarbonyloxymethyl]phenyl]nonadeca-9,12-dienoic acid (PubChem CID 154406320) has the molecular formula C51H83NO7 and a molecular weight of 822.22 g/mol. Its IUPAC name is (9Z,12Z)-19-[3-[(7Z,10Z)-18-carboxyoctadeca-7,10-dienyl]-5-[3-(dimethylamino)propoxycarbonyloxymethyl]phenyl]nonadeca-9,12-dienoic acid.
| Compound Name | (9Z,12Z)-19-[3-[(7Z,10Z)-18-carboxyoctadeca-7,10-dienyl]-5-[3-(dimethylamino)propoxycarbonyloxymethyl]phenyl]nonadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 154406320 |
| Molecular Formula | C51H83NO7 |
| Molecular Weight | 822.22 g/mol |
| Exact Mass | 821.62 |
| IUPAC Name | (9Z,12Z)-19-[3-[(7Z,10Z)-18-carboxyoctadeca-7,10-dienyl]-5-[3-(dimethylamino)propoxycarbonyloxymethyl]phenyl]nonadeca-9,12-dienoic acid |
| SMILES | CN(C)CCCOC(=O)OCc1cc(CCCCCC/C=C\C/C=C\CCCCCCCC(=O)O)cc(CCCCCC/C=C\C/C=C\CCCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C51H83NO7/c1-52(2)40-35-41-58-51(57)59-45-48-43-46(36-31-27-23-19-15-11-7-3-5-9-13-17-21-25-29-33-38-49(53)54)42-47(44-48)37-32-28-24-20-16-12-8-4-6-10-14-18-22-26-30-34-39-50(55)56/h5-12,42-44H,3-4,13-41,45H2,1-2H3,(H,53,54)(H,55,56)/b9-5-,10-6-,11-7-,12-8- |
| InChIKey | WJEKYXKDCNSWJQ-XIMJPLDWSA-N |
| XLogP | 13.91 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.22 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|