C54H89NO8 — CID 154406272
(9Z,12Z)-21-[3-[(9Z,12Z)-20-carboxyicosa-9,12-dienoxy]-5-[3-(dimethylamino)propanoyloxymethyl]phenoxy]henicosa-9,12-dienoic acid (PubChem CID 154406272) has the molecular formula C54H89NO8 and a molecular weight of 880.30 g/mol. Its IUPAC name is (9Z,12Z)-21-[3-[(9Z,12Z)-20-carboxyicosa-9,12-dienoxy]-5-[3-(dimethylamino)propanoyloxymethyl]phenoxy]henicosa-9,12-dienoic acid.
| Compound Name | (9Z,12Z)-21-[3-[(9Z,12Z)-20-carboxyicosa-9,12-dienoxy]-5-[3-(dimethylamino)propanoyloxymethyl]phenoxy]henicosa-9,12-dienoic acid |
|---|---|
| PubChem CID | 154406272 |
| Molecular Formula | C54H89NO8 |
| Molecular Weight | 880.30 g/mol |
| Exact Mass | 879.66 |
| IUPAC Name | (9Z,12Z)-21-[3-[(9Z,12Z)-20-carboxyicosa-9,12-dienoxy]-5-[3-(dimethylamino)propanoyloxymethyl]phenoxy]henicosa-9,12-dienoic acid |
| SMILES | CN(C)CCC(=O)OCc1cc(OCCCCCCCC/C=C\C/C=C\CCCCCCCC(=O)O)cc(OCCCCCCCC/C=C\C/C=C\CCCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C54H89NO8/c1-55(2)42-41-54(60)63-48-49-45-50(61-43-37-33-29-25-21-17-13-9-5-3-7-11-15-19-23-27-31-35-39-52(56)57)47-51(46-49)62-44-38-34-30-26-22-18-14-10-6-4-8-12-16-20-24-28-32-36-40-53(58)59/h5-12,45-47H,3-4,13-44,48H2,1-2H3,(H,56,57)(H,58,59)/b9-5-,10-6-,11-7-,12-8- |
| InChIKey | MAUPZWVJGLSAAZ-XIMJPLDWSA-N |
| XLogP | 14.54 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.30 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|