C47H74O7 — CID 154406335
(9Z,12Z)-20-[3-[(8Z,11Z)-19-carboxynonadeca-8,11-dienoxy]-5-formylphenoxy]icosa-9,12-dienoic acid (PubChem CID 154406335) has the molecular formula C47H74O7 and a molecular weight of 751.10 g/mol. Its IUPAC name is (9Z,12Z)-20-[3-[(8Z,11Z)-19-carboxynonadeca-8,11-dienoxy]-5-formylphenoxy]icosa-9,12-dienoic acid.
| Compound Name | (9Z,12Z)-20-[3-[(8Z,11Z)-19-carboxynonadeca-8,11-dienoxy]-5-formylphenoxy]icosa-9,12-dienoic acid |
|---|---|
| PubChem CID | 154406335 |
| Molecular Formula | C47H74O7 |
| Molecular Weight | 751.10 g/mol |
| Exact Mass | 750.54 |
| IUPAC Name | (9Z,12Z)-20-[3-[(8Z,11Z)-19-carboxynonadeca-8,11-dienoxy]-5-formylphenoxy]icosa-9,12-dienoic acid |
| SMILES | O=Cc1cc(OCCCCCCC/C=C\C/C=C\CCCCCCCC(=O)O)cc(OCCCCCCC/C=C\C/C=C\CCCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C47H74O7/c48-42-43-39-44(53-37-33-29-25-21-17-13-9-5-1-3-7-11-15-19-23-27-31-35-46(49)50)41-45(40-43)54-38-34-30-26-22-18-14-10-6-2-4-8-12-16-20-24-28-32-36-47(51)52/h3-10,39-42H,1-2,11-38H2,(H,49,50)(H,51,52)/b7-3-,8-4-,9-5-,10-6- |
| InChIKey | JCWLUORXIXYYPV-MERKUPPJSA-N |
| XLogP | 13.57 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.10 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|