11-(3,5-dihydroxyphenoxy)undecanoic acid

C17H26O5 — CID 42626374

IUPAC11-(3,5-dihydroxyphenoxy)undecanoic acid
SMILESO=C(O)CCCCCCCCCCOc1cc(O)cc(O)c1
InChIInChI=1S/C17H26O5/c18-14-11-15(19)13-16(12-14)22-10-8-6-4-2-1-3-5-7-9-17(20)21/h11-13,18-19H,1-10H2,(H,20,21)
InChIKeyXXOKMRZJBTYDNN-UHFFFAOYSA-N
MW310.39 g/mol
LogP4.07
Rot. Bonds12

About 11-(3,5-dihydroxyphenoxy)undecanoic acid

11-(3,5-dihydroxyphenoxy)undecanoic acid (PubChem CID 42626374) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is 11-(3,5-dihydroxyphenoxy)undecanoic acid.

Molecular Properties

Compound Name11-(3,5-dihydroxyphenoxy)undecanoic acid
PubChem CID42626374
Molecular FormulaC17H26O5
Molecular Weight310.39 g/mol
Exact Mass310.18
IUPAC Name11-(3,5-dihydroxyphenoxy)undecanoic acid
SMILESO=C(O)CCCCCCCCCCOc1cc(O)cc(O)c1
InChIInChI=1S/C17H26O5/c18-14-11-15(19)13-16(12-14)22-10-8-6-4-2-1-3-5-7-9-17(20)21/h11-13,18-19H,1-10H2,(H,20,21)
InChIKeyXXOKMRZJBTYDNN-UHFFFAOYSA-N
XLogP4.07
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds12
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.39
LogP ≤ 54.07
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 11-(3,5-dihydroxyphenoxy)undecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 11-(3,5-dihydroxyphenoxy)undecanoic acid?
The IUPAC name of 11-(3,5-dihydroxyphenoxy)undecanoic acid (CID 42626374) is 11-(3,5-dihydroxyphenoxy)undecanoic acid.
What is the SMILES notation for 11-(3,5-dihydroxyphenoxy)undecanoic acid?
The canonical SMILES for 11-(3,5-dihydroxyphenoxy)undecanoic acid is O=C(O)CCCCCCCCCCOc1cc(O)cc(O)c1.
What is the InChIKey of 11-(3,5-dihydroxyphenoxy)undecanoic acid?
The InChIKey is XXOKMRZJBTYDNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O5/c18-14-11-15(19)13-16(12-14)22-10-8-6-4-2-1-3-5-7-9-17(20)21/h11-13,18-19H,1-10H2,(H,20,21).
What are the key properties of 11-(3,5-dihydroxyphenoxy)undecanoic acid?
11-(3,5-dihydroxyphenoxy)undecanoic acid has a molecular weight of 310.39 g/mol, XLogP of 4.07, 12 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(3,5-dihydroxyphenoxy)undecanoic acid is sourced from PubChem (CID 42626374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).