C55H101NO6 — CID 121282388
2-[4-[3-(5-carboxy-8-heptylpentadecoxy)-5-[(dimethylamino)methyl]phenoxy]butyl]-5-heptyldodecanoic acid (PubChem CID 121282388) has the molecular formula C55H101NO6 and a molecular weight of 872.41 g/mol. Its IUPAC name is 2-[4-[3-(5-carboxy-8-heptylpentadecoxy)-5-[(dimethylamino)methyl]phenoxy]butyl]-5-heptyldodecanoic acid.
| Compound Name | 2-[4-[3-(5-carboxy-8-heptylpentadecoxy)-5-[(dimethylamino)methyl]phenoxy]butyl]-5-heptyldodecanoic acid |
|---|---|
| PubChem CID | 121282388 |
| Molecular Formula | C55H101NO6 |
| Molecular Weight | 872.41 g/mol |
| Exact Mass | 871.76 |
| IUPAC Name | 2-[4-[3-(5-carboxy-8-heptylpentadecoxy)-5-[(dimethylamino)methyl]phenoxy]butyl]-5-heptyldodecanoic acid |
| SMILES | CCCCCCCC(CCCCCCC)CCC(CCCCOc1cc(CN(C)C)cc(OCCCCC(CCC(CCCCCCC)CCCCCCC)C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C55H101NO6/c1-7-11-15-19-23-31-47(32-24-20-16-12-8-2)37-39-50(54(57)58)35-27-29-41-61-52-43-49(46-56(5)6)44-53(45-52)62-42-30-28-36-51(55(59)60)40-38-48(33-25-21-17-13-9-3)34-26-22-18-14-10-4/h43-45,47-48,50-51H,7-42,46H2,1-6H3,(H,57,58)(H,59,60) |
| InChIKey | IZCPKYWUKKDHRZ-UHFFFAOYSA-N |
| XLogP | 16.48 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.41 |
| LogP ≤ 5 | 16.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|