C49H85NO10 — CID 121282331
(2R)-3-[2-[3-[(dimethylamino)methyl]-5-[(3S)-3,4-di(octanoyloxy)butoxy]phenoxy]ethyl]-2,5-dihexylhexanedioic acid (PubChem CID 121282331) has the molecular formula C49H85NO10 and a molecular weight of 848.22 g/mol. Its IUPAC name is (2R)-3-[2-[3-[(dimethylamino)methyl]-5-[(3S)-3,4-di(octanoyloxy)butoxy]phenoxy]ethyl]-2,5-dihexylhexanedioic acid.
| Compound Name | (2R)-3-[2-[3-[(dimethylamino)methyl]-5-[(3S)-3,4-di(octanoyloxy)butoxy]phenoxy]ethyl]-2,5-dihexylhexanedioic acid |
|---|---|
| PubChem CID | 121282331 |
| Molecular Formula | C49H85NO10 |
| Molecular Weight | 848.22 g/mol |
| Exact Mass | 847.62 |
| IUPAC Name | (2R)-3-[2-[3-[(dimethylamino)methyl]-5-[(3S)-3,4-di(octanoyloxy)butoxy]phenoxy]ethyl]-2,5-dihexylhexanedioic acid |
| SMILES | CCCCCCCC(=O)OC[C@H](CCOc1cc(CN(C)C)cc(OCCC(CC(CCCCCC)C(=O)O)[C@@H](CCCCCC)C(=O)O)c1)OC(=O)CCCCCCC |
| InChI | InChI=1S/C49H85NO10/c1-7-11-15-19-23-27-46(51)59-38-42(60-47(52)28-24-20-16-12-8-2)30-32-58-44-34-39(37-50(5)6)33-43(36-44)57-31-29-40(45(49(55)56)26-22-18-14-10-4)35-41(48(53)54)25-21-17-13-9-3/h33-34,36,40-42,45H,7-32,35,37-38H2,1-6H3,(H,53,54)(H,55,56)/t40?,41?,42-,45+/m0/s1 |
| InChIKey | BPNWTWPCPXNOKL-PYIYIJRFSA-N |
| XLogP | 11.81 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.22 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|