C49H87NO10 — CID 155027371
[4-[3-[(dimethylamino)methyl]-5-[4-(1-hydroxyoctoxy)-3-octanoyloxybutoxy]phenoxy]-2-octanoyloxybutyl] octanoate (PubChem CID 155027371) has the molecular formula C49H87NO10 and a molecular weight of 850.23 g/mol. Its IUPAC name is [4-[3-[(dimethylamino)methyl]-5-[4-(1-hydroxyoctoxy)-3-octanoyloxybutoxy]phenoxy]-2-octanoyloxybutyl] octanoate.
| Compound Name | [4-[3-[(dimethylamino)methyl]-5-[4-(1-hydroxyoctoxy)-3-octanoyloxybutoxy]phenoxy]-2-octanoyloxybutyl] octanoate |
|---|---|
| PubChem CID | 155027371 |
| Molecular Formula | C49H87NO10 |
| Molecular Weight | 850.23 g/mol |
| Exact Mass | 849.63 |
| IUPAC Name | [4-[3-[(dimethylamino)methyl]-5-[4-(1-hydroxyoctoxy)-3-octanoyloxybutoxy]phenoxy]-2-octanoyloxybutyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(CCOc1cc(CN(C)C)cc(OCCC(COC(O)CCCCCCC)OC(=O)CCCCCCC)c1)OC(=O)CCCCCCC |
| InChI | InChI=1S/C49H87NO10/c1-7-11-15-19-23-27-46(51)57-39-42(59-48(53)29-25-21-17-13-9-3)31-33-55-44-35-41(38-50(5)6)36-45(37-44)56-34-32-43(60-49(54)30-26-22-18-14-10-4)40-58-47(52)28-24-20-16-12-8-2/h35-37,42-43,46,51H,7-34,38-40H2,1-6H3 |
| InChIKey | PGYFFHBRWMQENT-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.23 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|