C50H85NO4 — CID 118916429
[4-methyl-2,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 4-(dimethylamino)butanoate (PubChem CID 118916429) has the molecular formula C50H85NO4 and a molecular weight of 764.23 g/mol. Its IUPAC name is [4-methyl-2,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 4-(dimethylamino)butanoate.
| Compound Name | [4-methyl-2,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 118916429 |
| Molecular Formula | C50H85NO4 |
| Molecular Weight | 764.23 g/mol |
| Exact Mass | 763.65 |
| IUPAC Name | [4-methyl-2,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 4-(dimethylamino)butanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOc1cc(COC(=O)CCCN(C)C)c(OCCCCCCCC/C=C\C/C=C\CCCCC)cc1C |
| InChI | InChI=1S/C50H85NO4/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41-53-48-44-47(45-55-50(52)39-38-40-51(4)5)49(43-46(48)3)54-42-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,43-44H,6-13,18-19,24-42,45H2,1-5H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | SFRXQXVSLOXCRJ-ZPPAUJSGSA-N |
| XLogP | 14.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.23 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|