C54H89NO7 — CID 86295224
4-[3-[(3-hydroxyazetidin-1-yl)methyl]-5-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 86295224) has the molecular formula C54H89NO7 and a molecular weight of 864.31 g/mol. Its IUPAC name is 4-[3-[(3-hydroxyazetidin-1-yl)methyl]-5-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 4-[3-[(3-hydroxyazetidin-1-yl)methyl]-5-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 86295224 |
| Molecular Formula | C54H89NO7 |
| Molecular Weight | 864.31 g/mol |
| Exact Mass | 863.66 |
| IUPAC Name | 4-[3-[(3-hydroxyazetidin-1-yl)methyl]-5-[4-[(9Z,12Z)-octadeca-9,12-dienoyl]oxybutoxy]phenoxy]butyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCCOc1cc(CN2CC(O)C2)cc(OCCCCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC)c1 |
| InChI | InChI=1S/C54H89NO7/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-37-53(57)61-41-35-33-39-59-51-43-49(46-55-47-50(56)48-55)44-52(45-51)60-40-34-36-42-62-54(58)38-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,43-45,50,56H,3-10,15-16,21-42,46-48H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | VPMPUHRYFDOFHQ-MAZCIEHSSA-N |
| XLogP | 13.89 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.31 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|