C51H87NO5 — CID 118916455
[2,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 3-(diethylamino)propyl carbonate (PubChem CID 118916455) has the molecular formula C51H87NO5 and a molecular weight of 794.26 g/mol. Its IUPAC name is [2,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 3-(diethylamino)propyl carbonate.
| Compound Name | [2,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 3-(diethylamino)propyl carbonate |
|---|---|
| PubChem CID | 118916455 |
| Molecular Formula | C51H87NO5 |
| Molecular Weight | 794.26 g/mol |
| Exact Mass | 793.66 |
| IUPAC Name | [2,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]phenyl]methyl 3-(diethylamino)propyl carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOc1ccc(OCCCCCCCC/C=C\C/C=C\CCCCC)c(COC(=O)OCCCN(CC)CC)c1 |
| InChI | InChI=1S/C51H87NO5/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43-54-49-40-41-50(48(46-49)47-57-51(53)56-45-39-42-52(7-3)8-4)55-44-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h15-18,21-24,40-41,46H,5-14,19-20,25-39,42-45,47H2,1-4H3/b17-15-,18-16-,23-21-,24-22- |
| InChIKey | UOOADKHWQCKVNH-MLLZQYMOSA-N |
| XLogP | 15.46 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.26 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|