C19H34O3 — CID 35027784
methyl (9E,11E,13R)-13-hydroxyoctadeca-9,11-dienoate (PubChem CID 35027784) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is methyl (9E,11E,13R)-13-hydroxyoctadeca-9,11-dienoate.
| Compound Name | methyl (9E,11E,13R)-13-hydroxyoctadeca-9,11-dienoate |
|---|---|
| PubChem CID | 35027784 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | methyl (9E,11E,13R)-13-hydroxyoctadeca-9,11-dienoate |
| SMILES | CCCCC[C@@H](O)/C=C/C=C/CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H34O3/c1-3-4-12-15-18(20)16-13-10-8-6-5-7-9-11-14-17-19(21)22-2/h8,10,13,16,18,20H,3-7,9,11-12,14-15,17H2,1-2H3/b10-8+,16-13+/t18-/m1/s1 |
| InChIKey | ZVMLLPSSQZSZOA-CUXIMIIRSA-N |
| XLogP | 4.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|