C23H42O4 — CID 21158586
methyl (10E,12E)-9-butylperoxyoctadeca-10,12-dienoate (PubChem CID 21158586) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is methyl (10E,12E)-9-butylperoxyoctadeca-10,12-dienoate.
| Compound Name | methyl (10E,12E)-9-butylperoxyoctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 21158586 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | methyl (10E,12E)-9-butylperoxyoctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C/C=C/C(CCCCCCCC(=O)OC)OOCCCC |
| InChI | InChI=1S/C23H42O4/c1-4-6-8-9-10-12-15-18-22(27-26-21-7-5-2)19-16-13-11-14-17-20-23(24)25-3/h10,12,15,18,22H,4-9,11,13-14,16-17,19-21H2,1-3H3/b12-10+,18-15+ |
| InChIKey | ZKZSTBGVBGBAAH-IZAPIVEJSA-N |
| XLogP | 6.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|