C26H33NO6 — CID 54119134
3-[5-(4-hydroxybutanoylamino)-2-[6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid (PubChem CID 54119134) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is 3-[5-(4-hydroxybutanoylamino)-2-[6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid.
| Compound Name | 3-[5-(4-hydroxybutanoylamino)-2-[6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54119134 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 3-[5-(4-hydroxybutanoylamino)-2-[6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid |
| SMILES | COc1ccc(C=CCCCCOc2ccc(NC(=O)CCCO)cc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C26H33NO6/c1-32-23-13-9-20(10-14-23)7-4-2-3-5-18-33-24-15-12-22(27-25(29)8-6-17-28)19-21(24)11-16-26(30)31/h4,7,9-10,12-15,19,28H,2-3,5-6,8,11,16-18H2,1H3,(H,27,29)(H,30,31) |
| InChIKey | NMKCMGBVXBOPKD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|