C26H31NO5 — CID 19957444
3-[6-(5-hydroxypent-1-ynyl)-3-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]propanoic acid (PubChem CID 19957444) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-[6-(5-hydroxypent-1-ynyl)-3-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]propanoic acid.
| Compound Name | 3-[6-(5-hydroxypent-1-ynyl)-3-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 19957444 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 3-[6-(5-hydroxypent-1-ynyl)-3-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]propanoic acid |
| SMILES | COc1ccc(/C=C/CCCCOc2ccc(C#CCCCO)nc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C26H31NO5/c1-31-23-14-11-21(12-15-23)9-5-2-3-8-20-32-25-17-13-22(10-6-4-7-19-28)27-24(25)16-18-26(29)30/h5,9,11-15,17,28H,2-4,7-8,16,18-20H2,1H3,(H,29,30)/b9-5+ |
| InChIKey | HJUVNPGJKWLPTO-WEVVVXLNSA-N |
| XLogP | 4.49 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|