C28H37NO6 — CID 67703760
methyl 5-[6-(3-methoxy-3-oxopropyl)-5-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]pentanoate (PubChem CID 67703760) has the molecular formula C28H37NO6 and a molecular weight of 483.61 g/mol. Its IUPAC name is methyl 5-[6-(3-methoxy-3-oxopropyl)-5-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]pentanoate.
| Compound Name | methyl 5-[6-(3-methoxy-3-oxopropyl)-5-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]pentanoate |
|---|---|
| PubChem CID | 67703760 |
| Molecular Formula | C28H37NO6 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | methyl 5-[6-(3-methoxy-3-oxopropyl)-5-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]pentanoate |
| SMILES | COC(=O)CCCCc1ccc(OCCCC/C=C/c2ccc(OC)cc2)c(CCC(=O)OC)n1 |
| InChI | InChI=1S/C28H37NO6/c1-32-24-16-13-22(14-17-24)10-6-4-5-9-21-35-26-19-15-23(11-7-8-12-27(30)33-2)29-25(26)18-20-28(31)34-3/h6,10,13-17,19H,4-5,7-9,11-12,18,20-21H2,1-3H3/b10-6+ |
| InChIKey | QGEOWEBTEKUDJY-UXBLZVDNSA-N |
| XLogP | 5.34 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|