C22H26INO4 — CID 86750763
methyl 3-[6-iodo-3-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]propanoate (PubChem CID 86750763) has the molecular formula C22H26INO4 and a molecular weight of 495.36 g/mol. Its IUPAC name is methyl 3-[6-iodo-3-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]propanoate.
| Compound Name | methyl 3-[6-iodo-3-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]propanoate |
|---|---|
| PubChem CID | 86750763 |
| Molecular Formula | C22H26INO4 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | methyl 3-[6-iodo-3-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-2-pyridinyl]propanoate |
| SMILES | COC(=O)CCc1nc(I)ccc1OCCCC/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H26INO4/c1-26-18-10-8-17(9-11-18)7-5-3-4-6-16-28-20-13-14-21(23)24-19(20)12-15-22(25)27-2/h5,7-11,13-14H,3-4,6,12,15-16H2,1-2H3/b7-5+ |
| InChIKey | VVSUUMFEMSDAKH-FNORWQNLSA-N |
| XLogP | 5.06 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|