C30H39NO6 — CID 19598040
3-[2-[6-(dimethylamino)-6-oxohexanoyl]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid (PubChem CID 19598040) has the molecular formula C30H39NO6 and a molecular weight of 509.64 g/mol. Its IUPAC name is 3-[2-[6-(dimethylamino)-6-oxohexanoyl]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[6-(dimethylamino)-6-oxohexanoyl]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 19598040 |
| Molecular Formula | C30H39NO6 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 3-[2-[6-(dimethylamino)-6-oxohexanoyl]-6-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]phenyl]propanoic acid |
| SMILES | COc1ccc(/C=C/CCCCOc2cccc(C(=O)CCCCC(=O)N(C)C)c2CCC(=O)O)cc1 |
| InChI | InChI=1S/C30H39NO6/c1-31(2)29(33)15-8-7-13-27(32)25-12-10-14-28(26(25)20-21-30(34)35)37-22-9-5-4-6-11-23-16-18-24(36-3)19-17-23/h6,10-12,14,16-19H,4-5,7-9,13,15,20-22H2,1-3H3,(H,34,35)/b11-6+ |
| InChIKey | JYXKWVGJISBYMQ-IZZDOVSWSA-N |
| XLogP | 5.81 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|