C25H41NO5S — CID 141223658
2-methoxy-5-[[(Z)-octadec-9-enoyl]amino]benzenesulfonic acid (PubChem CID 141223658) has the molecular formula C25H41NO5S and a molecular weight of 467.67 g/mol. Its IUPAC name is 2-methoxy-5-[[(Z)-octadec-9-enoyl]amino]benzenesulfonic acid.
| Compound Name | 2-methoxy-5-[[(Z)-octadec-9-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 141223658 |
| Molecular Formula | C25H41NO5S |
| Molecular Weight | 467.67 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 2-methoxy-5-[[(Z)-octadec-9-enoyl]amino]benzenesulfonic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Nc1ccc(OC)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C25H41NO5S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25(27)26-22-19-20-23(31-2)24(21-22)32(28,29)30/h10-11,19-21H,3-9,12-18H2,1-2H3,(H,26,27)(H,28,29,30)/b11-10- |
| InChIKey | YLUADVIHVIBIHO-KHPPLWFESA-N |
| XLogP | 6.92 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.67 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|