C29H49NO4 — CID 67862538
(E)-N-(2,4,6-trimethoxyphenyl)icos-11-enamide (PubChem CID 67862538) has the molecular formula C29H49NO4 and a molecular weight of 475.71 g/mol. Its IUPAC name is (E)-N-(2,4,6-trimethoxyphenyl)icos-11-enamide.
| Compound Name | (E)-N-(2,4,6-trimethoxyphenyl)icos-11-enamide |
|---|---|
| PubChem CID | 67862538 |
| Molecular Formula | C29H49NO4 |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.37 |
| IUPAC Name | (E)-N-(2,4,6-trimethoxyphenyl)icos-11-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCC(=O)Nc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C29H49NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-28(31)30-29-26(33-3)23-25(32-2)24-27(29)34-4/h12-13,23-24H,5-11,14-22H2,1-4H3,(H,30,31)/b13-12+ |
| InChIKey | OYZWGSJEVHQZET-OUKQBFOZSA-N |
| XLogP | 8.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|