C27H45NO4 — CID 14157095
(Z)-N-(2,4,6-trimethoxyphenyl)octadec-9-enamide (PubChem CID 14157095) has the molecular formula C27H45NO4 and a molecular weight of 447.66 g/mol. Its IUPAC name is (Z)-N-(2,4,6-trimethoxyphenyl)octadec-9-enamide.
| Compound Name | (Z)-N-(2,4,6-trimethoxyphenyl)octadec-9-enamide |
|---|---|
| PubChem CID | 14157095 |
| Molecular Formula | C27H45NO4 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.33 |
| IUPAC Name | (Z)-N-(2,4,6-trimethoxyphenyl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Nc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C27H45NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(29)28-27-24(31-3)21-23(30-2)22-25(27)32-4/h12-13,21-22H,5-11,14-20H2,1-4H3,(H,28,29)/b13-12- |
| InChIKey | YYMMCKTYZLLVOG-SEYXRHQNSA-N |
| XLogP | 7.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|