C13H16N2O4 — CID 21469465
3-cyano-N-(2,4,6-trimethoxyphenyl)propanamide (PubChem CID 21469465) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-cyano-N-(2,4,6-trimethoxyphenyl)propanamide.
| Compound Name | 3-cyano-N-(2,4,6-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 21469465 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-cyano-N-(2,4,6-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(OC)c(NC(=O)CCC#N)c(OC)c1 |
| InChI | InChI=1S/C13H16N2O4/c1-17-9-7-10(18-2)13(11(8-9)19-3)15-12(16)5-4-6-14/h7-8H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | DKKXEPDDBUKSCI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |