C12H13ClN2O2 — CID 115173505
N-(5-chloro-2-methoxy-4-methylphenyl)-3-cyanopropanamide (PubChem CID 115173505) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is N-(5-chloro-2-methoxy-4-methylphenyl)-3-cyanopropanamide.
| Compound Name | N-(5-chloro-2-methoxy-4-methylphenyl)-3-cyanopropanamide |
|---|---|
| PubChem CID | 115173505 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(5-chloro-2-methoxy-4-methylphenyl)-3-cyanopropanamide |
| SMILES | COc1cc(C)c(Cl)cc1NC(=O)CCC#N |
| InChI | InChI=1S/C12H13ClN2O2/c1-8-6-11(17-2)10(7-9(8)13)15-12(16)4-3-5-14/h6-7H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | KPBXWNGFOKCLSB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |