C11H13NO6 — CID 82499633
2-oxo-2-(2,4,6-trimethoxyanilino)acetic acid (PubChem CID 82499633) has the molecular formula C11H13NO6 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-oxo-2-(2,4,6-trimethoxyanilino)acetic acid.
| Compound Name | 2-oxo-2-(2,4,6-trimethoxyanilino)acetic acid |
|---|---|
| PubChem CID | 82499633 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-oxo-2-(2,4,6-trimethoxyanilino)acetic acid |
| SMILES | COc1cc(OC)c(NC(=O)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C11H13NO6/c1-16-6-4-7(17-2)9(8(5-6)18-3)12-10(13)11(14)15/h4-5H,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | ULIIZWBLYZFUNB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|