C10H16N3O7P — CID 19764431
[2-[(2,4,6-trimethoxyphenyl)carbamoyl]hydrazinyl]phosphonic acid (PubChem CID 19764431) has the molecular formula C10H16N3O7P and a molecular weight of 321.23 g/mol. Its IUPAC name is [2-[(2,4,6-trimethoxyphenyl)carbamoyl]hydrazinyl]phosphonic acid.
| Compound Name | [2-[(2,4,6-trimethoxyphenyl)carbamoyl]hydrazinyl]phosphonic acid |
|---|---|
| PubChem CID | 19764431 |
| Molecular Formula | C10H16N3O7P |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | [2-[(2,4,6-trimethoxyphenyl)carbamoyl]hydrazinyl]phosphonic acid |
| SMILES | COc1cc(OC)c(NC(=O)NNP(=O)(O)O)c(OC)c1 |
| InChI | InChI=1S/C10H16N3O7P/c1-18-6-4-7(19-2)9(8(5-6)20-3)11-10(14)12-13-21(15,16)17/h4-5H,1-3H3,(H2,11,12,14)(H3,13,15,16,17) |
| InChIKey | RYJKSZOYUILZMR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 138.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|