C11H14N6O4 — CID 10851307
1-(2H-tetrazol-5-yl)-3-(2,4,6-trimethoxyphenyl)urea (PubChem CID 10851307) has the molecular formula C11H14N6O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is 1-(2H-tetrazol-5-yl)-3-(2,4,6-trimethoxyphenyl)urea.
| Compound Name | 1-(2H-tetrazol-5-yl)-3-(2,4,6-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 10851307 |
| Molecular Formula | C11H14N6O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1-(2H-tetrazol-5-yl)-3-(2,4,6-trimethoxyphenyl)urea |
| SMILES | COc1cc(OC)c(NC(=O)Nc2nn[nH]n2)c(OC)c1 |
| InChI | InChI=1S/C11H14N6O4/c1-19-6-4-7(20-2)9(8(5-6)21-3)12-11(18)13-10-14-16-17-15-10/h4-5H,1-3H3,(H3,12,13,14,15,16,17,18) |
| InChIKey | QANYKXSTHDIXML-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |