C14H11ClN6O2 — CID 12784865
6-(4-chlorophenyl)-4-methoxy-N-(2H-tetrazol-5-yl)pyridine-2-carboxamide (PubChem CID 12784865) has the molecular formula C14H11ClN6O2 and a molecular weight of 330.74 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-4-methoxy-N-(2H-tetrazol-5-yl)pyridine-2-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-4-methoxy-N-(2H-tetrazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 12784865 |
| Molecular Formula | C14H11ClN6O2 |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 6-(4-chlorophenyl)-4-methoxy-N-(2H-tetrazol-5-yl)pyridine-2-carboxamide |
| SMILES | COc1cc(C(=O)Nc2nn[nH]n2)nc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C14H11ClN6O2/c1-23-10-6-11(8-2-4-9(15)5-3-8)16-12(7-10)13(22)17-14-18-20-21-19-14/h2-7H,1H3,(H2,17,18,19,20,21,22) |
| InChIKey | HCMWTEBNYMEWEF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |