C12H10N6O2 — CID 139676219
5-(4-methylphenyl)-N-(2H-tetrazol-5-yl)-1,2-oxazole-3-carboxamide (PubChem CID 139676219) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 5-(4-methylphenyl)-N-(2H-tetrazol-5-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-methylphenyl)-N-(2H-tetrazol-5-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 139676219 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 5-(4-methylphenyl)-N-(2H-tetrazol-5-yl)-1,2-oxazole-3-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3nn[nH]n3)no2)cc1 |
| InChI | InChI=1S/C12H10N6O2/c1-7-2-4-8(5-3-7)10-6-9(16-20-10)11(19)13-12-14-17-18-15-12/h2-6H,1H3,(H2,13,14,15,17,18,19) |
| InChIKey | XZXVMELIXASZSX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |